C29H38N2 — CID 175547828
4,6-bis(3-methylphenyl)-2-(2,2,6,6-tetramethylheptan-4-yl)pyrimidine (PubChem CID 175547828) has the molecular formula C29H38N2 and a molecular weight of 414.64 g/mol. Its IUPAC name is 4,6-bis(3-methylphenyl)-2-(2,2,6,6-tetramethylheptan-4-yl)pyrimidine.
| Compound Name | 4,6-bis(3-methylphenyl)-2-(2,2,6,6-tetramethylheptan-4-yl)pyrimidine |
|---|---|
| PubChem CID | 175547828 |
| Molecular Formula | C29H38N2 |
| Molecular Weight | 414.64 g/mol |
| Exact Mass | 414.30 |
| IUPAC Name | 4,6-bis(3-methylphenyl)-2-(2,2,6,6-tetramethylheptan-4-yl)pyrimidine |
| SMILES | Cc1cccc(-c2cc(-c3cccc(C)c3)nc(C(CC(C)(C)C)CC(C)(C)C)n2)c1 |
| InChI | InChI=1S/C29H38N2/c1-20-11-9-13-22(15-20)25-17-26(23-14-10-12-21(2)16-23)31-27(30-25)24(18-28(3,4)5)19-29(6,7)8/h9-17,24H,18-19H2,1-8H3 |
| InChIKey | DEKXUTHCOCOMIJ-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.64 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |