C19H14N2O3 — CID 175548904
[5-(1H-indol-3-yl)-2-methylphenyl] 1,3-oxazole-4-carboxylate (PubChem CID 175548904) has the molecular formula C19H14N2O3 and a molecular weight of 318.33 g/mol. Its IUPAC name is [5-(1H-indol-3-yl)-2-methylphenyl] 1,3-oxazole-4-carboxylate.
| Compound Name | [5-(1H-indol-3-yl)-2-methylphenyl] 1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 175548904 |
| Molecular Formula | C19H14N2O3 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | [5-(1H-indol-3-yl)-2-methylphenyl] 1,3-oxazole-4-carboxylate |
| SMILES | Cc1ccc(-c2c[nH]c3ccccc23)cc1OC(=O)c1cocn1 |
| InChI | InChI=1S/C19H14N2O3/c1-12-6-7-13(15-9-20-16-5-3-2-4-14(15)16)8-18(12)24-19(22)17-10-23-11-21-17/h2-11,20H,1H3 |
| InChIKey | UXBJQFAUVCXOLM-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|