About 4-aminooxybenzaldehyde;propanamide
4-aminooxybenzaldehyde;propanamide (PubChem CID 175549934) has the molecular formula C10H14N2O3
and a molecular weight of 210.23 g/mol. Its IUPAC name is 4-aminooxybenzaldehyde;propanamide.
Molecular Properties
| Compound Name | 4-aminooxybenzaldehyde;propanamide |
| PubChem CID | 175549934 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 4-aminooxybenzaldehyde;propanamide |
| SMILES | CCC(N)=O.NOc1ccc(C=O)cc1 |
| InChI | InChI=1S/C7H7NO2.C3H7NO/c8-10-7-3-1-6(5-9)2-4-7;1-2-3(4)5/h1-5H,8H2;2H2,1H3,(H2,4,5) |
| InChIKey | RODNWGGCDIAPIK-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-aminooxybenzaldehyde;propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminooxybenzaldehyde;propanamide?
The IUPAC name of 4-aminooxybenzaldehyde;propanamide (CID 175549934) is 4-aminooxybenzaldehyde;propanamide.
What is the SMILES notation for 4-aminooxybenzaldehyde;propanamide?
The canonical SMILES for 4-aminooxybenzaldehyde;propanamide is CCC(N)=O.NOc1ccc(C=O)cc1.
What is the InChIKey of 4-aminooxybenzaldehyde;propanamide?
The InChIKey is RODNWGGCDIAPIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2.C3H7NO/c8-10-7-3-1-6(5-9)2-4-7;1-2-3(4)5/h1-5H,8H2;2H2,1H3,(H2,4,5).
What are the key properties of 4-aminooxybenzaldehyde;propanamide?
4-aminooxybenzaldehyde;propanamide has a molecular weight of 210.23 g/mol, XLogP of 0.63, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminooxybenzaldehyde;propanamide is sourced from PubChem (CID 175549934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).