C14H24O3 — CID 175551749
benzene-1,2-diol;2-methyl-1-(2-methylpropoxy)propane (PubChem CID 175551749) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is benzene-1,2-diol;2-methyl-1-(2-methylpropoxy)propane.
| Compound Name | benzene-1,2-diol;2-methyl-1-(2-methylpropoxy)propane |
|---|---|
| PubChem CID | 175551749 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | benzene-1,2-diol;2-methyl-1-(2-methylpropoxy)propane |
| SMILES | CC(C)COCC(C)C.Oc1ccccc1O |
| InChI | InChI=1S/C8H18O.C6H6O2/c1-7(2)5-9-6-8(3)4;7-5-3-1-2-4-6(5)8/h7-8H,5-6H2,1-4H3;1-4,7-8H |
| InChIKey | UOLKUBBJROQXTC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|