C15H19BrN2O3 — CID 175556350
tert-butyl 3-[5-bromo-2-(cyclopropylamino)-3-pyridinyl]-3-oxopropanoate (PubChem CID 175556350) has the molecular formula C15H19BrN2O3 and a molecular weight of 355.23 g/mol. Its IUPAC name is tert-butyl 3-[5-bromo-2-(cyclopropylamino)-3-pyridinyl]-3-oxopropanoate.
| Compound Name | tert-butyl 3-[5-bromo-2-(cyclopropylamino)-3-pyridinyl]-3-oxopropanoate |
|---|---|
| PubChem CID | 175556350 |
| Molecular Formula | C15H19BrN2O3 |
| Molecular Weight | 355.23 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | tert-butyl 3-[5-bromo-2-(cyclopropylamino)-3-pyridinyl]-3-oxopropanoate |
| SMILES | CC(C)(C)OC(=O)CC(=O)c1cc(Br)cnc1NC1CC1 |
| InChI | InChI=1S/C15H19BrN2O3/c1-15(2,3)21-13(20)7-12(19)11-6-9(16)8-17-14(11)18-10-4-5-10/h6,8,10H,4-5,7H2,1-3H3,(H,17,18) |
| InChIKey | FVKUYIGXEDCABC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.23 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|