C8H9F3N2O — CID 175557119
6-methyl-2-(1,2,2-trifluoroethoxy)pyridin-3-amine (PubChem CID 175557119) has the molecular formula C8H9F3N2O and a molecular weight of 206.17 g/mol. Its IUPAC name is 6-methyl-2-(1,2,2-trifluoroethoxy)pyridin-3-amine.
| Compound Name | 6-methyl-2-(1,2,2-trifluoroethoxy)pyridin-3-amine |
|---|---|
| PubChem CID | 175557119 |
| Molecular Formula | C8H9F3N2O |
| Molecular Weight | 206.17 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 6-methyl-2-(1,2,2-trifluoroethoxy)pyridin-3-amine |
| SMILES | Cc1ccc(N)c(OC(F)C(F)F)n1 |
| InChI | InChI=1S/C8H9F3N2O/c1-4-2-3-5(12)8(13-4)14-7(11)6(9)10/h2-3,6-7H,12H2,1H3 |
| InChIKey | DRCHRALZAWZEDN-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.17 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |