About diphenylgermane;methane
diphenylgermane;methane (PubChem CID 175558529) has the molecular formula C13H16Ge
and a molecular weight of 244.88 g/mol. Its IUPAC name is diphenylgermane;methane.
Molecular Properties
| Compound Name | diphenylgermane;methane |
| PubChem CID | 175558529 |
| Molecular Formula | C13H16Ge |
| Molecular Weight | 244.88 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | diphenylgermane;methane |
| SMILES | C.c1ccc([GeH2]c2ccccc2)cc1 |
| InChI | InChI=1S/C12H12Ge.CH4/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;/h1-10H,13H2;1H4 |
| InChIKey | OWZDQVNGKXZUIP-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.88 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze diphenylgermane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylgermane;methane?
The IUPAC name of diphenylgermane;methane (CID 175558529) is diphenylgermane;methane.
What is the SMILES notation for diphenylgermane;methane?
The canonical SMILES for diphenylgermane;methane is C.c1ccc([GeH2]c2ccccc2)cc1.
What is the InChIKey of diphenylgermane;methane?
The InChIKey is OWZDQVNGKXZUIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12Ge.CH4/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;/h1-10H,13H2;1H4.
What are the key properties of diphenylgermane;methane?
diphenylgermane;methane has a molecular weight of 244.88 g/mol, XLogP of 1.44, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylgermane;methane is sourced from PubChem (CID 175558529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).