C15H16F3NO4 — CID 175559382
ethyl 2-(prop-2-enoylamino)-4-(1,2,3-trifluoropropoxy)benzoate (PubChem CID 175559382) has the molecular formula C15H16F3NO4 and a molecular weight of 331.29 g/mol. Its IUPAC name is ethyl 2-(prop-2-enoylamino)-4-(1,2,3-trifluoropropoxy)benzoate.
| Compound Name | ethyl 2-(prop-2-enoylamino)-4-(1,2,3-trifluoropropoxy)benzoate |
|---|---|
| PubChem CID | 175559382 |
| Molecular Formula | C15H16F3NO4 |
| Molecular Weight | 331.29 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | ethyl 2-(prop-2-enoylamino)-4-(1,2,3-trifluoropropoxy)benzoate |
| SMILES | C=CC(=O)Nc1cc(OC(F)C(F)CF)ccc1C(=O)OCC |
| InChI | InChI=1S/C15H16F3NO4/c1-3-13(20)19-12-7-9(23-14(18)11(17)8-16)5-6-10(12)15(21)22-4-2/h3,5-7,11,14H,1,4,8H2,2H3,(H,19,20) |
| InChIKey | WIXSTAOJGRGVRP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.29 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|