C24H22BrFN3O3+ — CID 175567612
N-[[3-[4-[1-[(4-bromophenyl)methyl]pyridin-1-ium-4-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 175567612) has the molecular formula C24H22BrFN3O3+ and a molecular weight of 499.36 g/mol. Its IUPAC name is N-[[3-[4-[1-[(4-bromophenyl)methyl]pyridin-1-ium-4-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[3-[4-[1-[(4-bromophenyl)methyl]pyridin-1-ium-4-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 175567612 |
| Molecular Formula | C24H22BrFN3O3+ |
| Molecular Weight | 499.36 g/mol |
| Exact Mass | 498.08 |
| IUPAC Name | N-[[3-[4-[1-[(4-bromophenyl)methyl]pyridin-1-ium-4-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NCC1CN(c2ccc(-c3cc[n+](Cc4ccc(Br)cc4)cc3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C24H21BrFN3O3/c1-16(30)27-13-21-15-29(24(31)32-21)20-6-7-22(23(26)12-20)18-8-10-28(11-9-18)14-17-2-4-19(25)5-3-17/h2-12,21H,13-15H2,1H3/p+1 |
| InChIKey | LFRPPCGPZWZRJW-UHFFFAOYSA-O |
| XLogP | 4.05 |
| TPSA | 62.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.36 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|