C7H14ClNO6 — CID 175569616
2-hydroxybutanedioic acid;1,3-oxazolidine;hydrochloride (PubChem CID 175569616) has the molecular formula C7H14ClNO6 and a molecular weight of 243.64 g/mol. Its IUPAC name is 2-hydroxybutanedioic acid;1,3-oxazolidine;hydrochloride.
| Compound Name | 2-hydroxybutanedioic acid;1,3-oxazolidine;hydrochloride |
|---|---|
| PubChem CID | 175569616 |
| Molecular Formula | C7H14ClNO6 |
| Molecular Weight | 243.64 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 2-hydroxybutanedioic acid;1,3-oxazolidine;hydrochloride |
| SMILES | C1COCN1.Cl.O=C(O)CC(O)C(=O)O |
| InChI | InChI=1S/C4H6O5.C3H7NO.ClH/c5-2(4(8)9)1-3(6)7;1-2-5-3-4-1;/h2,5H,1H2,(H,6,7)(H,8,9);4H,1-3H2;1H |
| InChIKey | DASBLKQGESWYEH-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.64 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |