C24H39N3O6 — CID 175571528
tert-butyl 5-[3-(4-aminobutanoylamino)-4-hydroxyphenyl]-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate (PubChem CID 175571528) has the molecular formula C24H39N3O6 and a molecular weight of 465.59 g/mol. Its IUPAC name is tert-butyl 5-[3-(4-aminobutanoylamino)-4-hydroxyphenyl]-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate.
| Compound Name | tert-butyl 5-[3-(4-aminobutanoylamino)-4-hydroxyphenyl]-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
|---|---|
| PubChem CID | 175571528 |
| Molecular Formula | C24H39N3O6 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.28 |
| IUPAC Name | tert-butyl 5-[3-(4-aminobutanoylamino)-4-hydroxyphenyl]-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
| SMILES | CC(C)(C)OC(=O)CCC(Cc1ccc(O)c(NC(=O)CCCN)c1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H39N3O6/c1-23(2,3)32-21(30)12-10-17(26-22(31)33-24(4,5)6)14-16-9-11-19(28)18(15-16)27-20(29)8-7-13-25/h9,11,15,17,28H,7-8,10,12-14,25H2,1-6H3,(H,26,31)(H,27,29) |
| InChIKey | OYHKRCIUGDEMOS-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 139.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|