C23H10Cl3F7N2O2 — CID 175576813
5-[1-carbamoyl-2,2-dichloro-3-(2,3,4,5,6-pentafluorophenyl)cyclopropyl]-2-chloro-N-(2,4-difluorophenyl)benzamide (PubChem CID 175576813) has the molecular formula C23H10Cl3F7N2O2 and a molecular weight of 585.69 g/mol. Its IUPAC name is 5-[1-carbamoyl-2,2-dichloro-3-(2,3,4,5,6-pentafluorophenyl)cyclopropyl]-2-chloro-N-(2,4-difluorophenyl)benzamide.
| Compound Name | 5-[1-carbamoyl-2,2-dichloro-3-(2,3,4,5,6-pentafluorophenyl)cyclopropyl]-2-chloro-N-(2,4-difluorophenyl)benzamide |
|---|---|
| PubChem CID | 175576813 |
| Molecular Formula | C23H10Cl3F7N2O2 |
| Molecular Weight | 585.69 g/mol |
| Exact Mass | 583.97 |
| IUPAC Name | 5-[1-carbamoyl-2,2-dichloro-3-(2,3,4,5,6-pentafluorophenyl)cyclopropyl]-2-chloro-N-(2,4-difluorophenyl)benzamide |
| SMILES | NC(=O)C1(c2ccc(Cl)c(C(=O)Nc3ccc(F)cc3F)c2)C(c2c(F)c(F)c(F)c(F)c2F)C1(Cl)Cl |
| InChI | InChI=1S/C23H10Cl3F7N2O2/c24-10-3-1-7(5-9(10)20(36)35-12-4-2-8(27)6-11(12)28)22(21(34)37)19(23(22,25)26)13-14(29)16(31)18(33)17(32)15(13)30/h1-6,19H,(H2,34,37)(H,35,36) |
| InChIKey | TZZNRAGRJSTOPH-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.69 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|