C25H16Cl5FN2O2 — CID 175576577
5-[1-carbamoyl-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropyl]-2-chloro-N-(4-ethenyl-2-fluorophenyl)benzamide (PubChem CID 175576577) has the molecular formula C25H16Cl5FN2O2 and a molecular weight of 572.68 g/mol. Its IUPAC name is 5-[1-carbamoyl-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropyl]-2-chloro-N-(4-ethenyl-2-fluorophenyl)benzamide.
| Compound Name | 5-[1-carbamoyl-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropyl]-2-chloro-N-(4-ethenyl-2-fluorophenyl)benzamide |
|---|---|
| PubChem CID | 175576577 |
| Molecular Formula | C25H16Cl5FN2O2 |
| Molecular Weight | 572.68 g/mol |
| Exact Mass | 569.96 |
| IUPAC Name | 5-[1-carbamoyl-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropyl]-2-chloro-N-(4-ethenyl-2-fluorophenyl)benzamide |
| SMILES | C=Cc1ccc(NC(=O)c2cc(C3(C(N)=O)C(c4cc(Cl)cc(Cl)c4)C3(Cl)Cl)ccc2Cl)c(F)c1 |
| InChI | InChI=1S/C25H16Cl5FN2O2/c1-2-12-3-6-20(19(31)7-12)33-22(34)17-10-14(4-5-18(17)28)24(23(32)35)21(25(24,29)30)13-8-15(26)11-16(27)9-13/h2-11,21H,1H2,(H2,32,35)(H,33,34) |
| InChIKey | QHKFJUHSOJTUAE-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.68 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|