C25H18Cl5N3O4 — CID 175576812
5-[1-carbamoyl-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropyl]-2-chloro-N-(2,5-dimethyl-4-nitrophenyl)benzamide (PubChem CID 175576812) has the molecular formula C25H18Cl5N3O4 and a molecular weight of 601.70 g/mol. Its IUPAC name is 5-[1-carbamoyl-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropyl]-2-chloro-N-(2,5-dimethyl-4-nitrophenyl)benzamide.
| Compound Name | 5-[1-carbamoyl-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropyl]-2-chloro-N-(2,5-dimethyl-4-nitrophenyl)benzamide |
|---|---|
| PubChem CID | 175576812 |
| Molecular Formula | C25H18Cl5N3O4 |
| Molecular Weight | 601.70 g/mol |
| Exact Mass | 598.97 |
| IUPAC Name | 5-[1-carbamoyl-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropyl]-2-chloro-N-(2,5-dimethyl-4-nitrophenyl)benzamide |
| SMILES | Cc1cc([N+](=O)[O-])c(C)cc1NC(=O)c1cc(C2(C(N)=O)C(c3cc(Cl)cc(Cl)c3)C2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C25H18Cl5N3O4/c1-11-6-20(33(36)37)12(2)5-19(11)32-22(34)17-9-14(3-4-18(17)28)24(23(31)35)21(25(24,29)30)13-7-15(26)10-16(27)8-13/h3-10,21H,1-2H3,(H2,31,35)(H,32,34) |
| InChIKey | NFHMTGWDKDTLPP-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.70 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|