About 1-hexyl-3-methylimidazol-3-ium;1-methylimidazole;hydrobromide
1-hexyl-3-methylimidazol-3-ium;1-methylimidazole;hydrobromide (PubChem CID 175577150) has the molecular formula C14H26BrN4+
and a molecular weight of 330.29 g/mol. Its IUPAC name is 1-hexyl-3-methylimidazol-3-ium;1-methylimidazole;hydrobromide.
Molecular Properties
| Compound Name | 1-hexyl-3-methylimidazol-3-ium;1-methylimidazole;hydrobromide |
| PubChem CID | 175577150 |
| Molecular Formula | C14H26BrN4+ |
| Molecular Weight | 330.29 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 1-hexyl-3-methylimidazol-3-ium;1-methylimidazole;hydrobromide |
| SMILES | Br.CCCCCCn1cc[n+](C)c1.Cn1ccnc1 |
| InChI | InChI=1S/C10H19N2.C4H6N2.BrH/c1-3-4-5-6-7-12-9-8-11(2)10-12;1-6-3-2-5-4-6;/h8-10H,3-7H2,1-2H3;2-4H,1H3;1H/q+1;; |
| InChIKey | QOZSGCOPQRRPNP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 26.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.29 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-hexyl-3-methylimidazol-3-ium;1-methylimidazole;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hexyl-3-methylimidazol-3-ium;1-methylimidazole;hydrobromide?
The IUPAC name of 1-hexyl-3-methylimidazol-3-ium;1-methylimidazole;hydrobromide (CID 175577150) is 1-hexyl-3-methylimidazol-3-ium;1-methylimidazole;hydrobromide.
What is the SMILES notation for 1-hexyl-3-methylimidazol-3-ium;1-methylimidazole;hydrobromide?
The canonical SMILES for 1-hexyl-3-methylimidazol-3-ium;1-methylimidazole;hydrobromide is Br.CCCCCCn1cc[n+](C)c1.Cn1ccnc1.
What is the InChIKey of 1-hexyl-3-methylimidazol-3-ium;1-methylimidazole;hydrobromide?
The InChIKey is QOZSGCOPQRRPNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N2.C4H6N2.BrH/c1-3-4-5-6-7-12-9-8-11(2)10-12;1-6-3-2-5-4-6;/h8-10H,3-7H2,1-2H3;2-4H,1H3;1H/q+1;;.
What are the key properties of 1-hexyl-3-methylimidazol-3-ium;1-methylimidazole;hydrobromide?
1-hexyl-3-methylimidazol-3-ium;1-methylimidazole;hydrobromide has a molecular weight of 330.29 g/mol, XLogP of 2.89, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hexyl-3-methylimidazol-3-ium;1-methylimidazole;hydrobromide is sourced from PubChem (CID 175577150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).