C20H16N2O3 — CID 175580971
3-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-pyridinyl]benzamide (PubChem CID 175580971) has the molecular formula C20H16N2O3 and a molecular weight of 332.36 g/mol. Its IUPAC name is 3-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-pyridinyl]benzamide.
| Compound Name | 3-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 175580971 |
| Molecular Formula | C20H16N2O3 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 3-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-pyridinyl]benzamide |
| SMILES | NC(=O)c1cccc(-c2cc(-c3ccc4c(c3)OCCO4)ccn2)c1 |
| InChI | InChI=1S/C20H16N2O3/c21-20(23)16-3-1-2-15(10-16)17-11-14(6-7-22-17)13-4-5-18-19(12-13)25-9-8-24-18/h1-7,10-12H,8-9H2,(H2,21,23) |
| InChIKey | BBJYRMSURYMSNZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |