C17H16N4O2 — CID 170147701
(Z)-3-amino-3-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)phenyl]-2-hydrazinylprop-2-enenitrile (PubChem CID 170147701) has the molecular formula C17H16N4O2 and a molecular weight of 308.34 g/mol. Its IUPAC name is (Z)-3-amino-3-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)phenyl]-2-hydrazinylprop-2-enenitrile.
| Compound Name | (Z)-3-amino-3-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)phenyl]-2-hydrazinylprop-2-enenitrile |
|---|---|
| PubChem CID | 170147701 |
| Molecular Formula | C17H16N4O2 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | (Z)-3-amino-3-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)phenyl]-2-hydrazinylprop-2-enenitrile |
| SMILES | N#C/C(NN)=C(/N)c1cccc(-c2ccc3c(c2)OCCO3)c1 |
| InChI | InChI=1S/C17H16N4O2/c18-10-14(21-20)17(19)13-3-1-2-11(8-13)12-4-5-15-16(9-12)23-7-6-22-15/h1-5,8-9,21H,6-7,19-20H2/b17-14- |
| InChIKey | FFODIYZFLMEXAE-VKAVYKQESA-N |
| XLogP | 1.74 |
| TPSA | 106.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|