C16H16N4 — CID 170147789
(Z)-3-amino-2-hydrazinyl-3-[3-(4-methylphenyl)phenyl]prop-2-enenitrile (PubChem CID 170147789) has the molecular formula C16H16N4 and a molecular weight of 264.33 g/mol. Its IUPAC name is (Z)-3-amino-2-hydrazinyl-3-[3-(4-methylphenyl)phenyl]prop-2-enenitrile.
| Compound Name | (Z)-3-amino-2-hydrazinyl-3-[3-(4-methylphenyl)phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 170147789 |
| Molecular Formula | C16H16N4 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | (Z)-3-amino-2-hydrazinyl-3-[3-(4-methylphenyl)phenyl]prop-2-enenitrile |
| SMILES | Cc1ccc(-c2cccc(/C(N)=C(\C#N)NN)c2)cc1 |
| InChI | InChI=1S/C16H16N4/c1-11-5-7-12(8-6-11)13-3-2-4-14(9-13)16(18)15(10-17)20-19/h2-9,20H,18-19H2,1H3/b16-15- |
| InChIKey | MDQWXKMCCQHSRX-NXVVXOECSA-N |
| XLogP | 2.28 |
| TPSA | 87.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|