C31H62F6N2O6S2 — CID 175583602
3-ethyl-1-octylpyrrolidine;1-octyl-3-propylpyrrolidine;bis(trifluoromethanesulfonic acid) (PubChem CID 175583602) has the molecular formula C31H62F6N2O6S2 and a molecular weight of 736.97 g/mol. Its IUPAC name is 3-ethyl-1-octylpyrrolidine;1-octyl-3-propylpyrrolidine;bis(trifluoromethanesulfonic acid).
| Compound Name | 3-ethyl-1-octylpyrrolidine;1-octyl-3-propylpyrrolidine;bis(trifluoromethanesulfonic acid) |
|---|---|
| PubChem CID | 175583602 |
| Molecular Formula | C31H62F6N2O6S2 |
| Molecular Weight | 736.97 g/mol |
| Exact Mass | 736.40 |
| IUPAC Name | 3-ethyl-1-octylpyrrolidine;1-octyl-3-propylpyrrolidine;bis(trifluoromethanesulfonic acid) |
| SMILES | CCCCCCCCN1CCC(CC)C1.CCCCCCCCN1CCC(CCC)C1.O=S(=O)(O)C(F)(F)F.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C15H31N.C14H29N.2CHF3O3S/c1-3-5-6-7-8-9-12-16-13-11-15(14-16)10-4-2;1-3-5-6-7-8-9-11-15-12-10-14(4-2)13-15;2*2-1(3,4)8(5,6)7/h15H,3-14H2,1-2H3;14H,3-13H2,1-2H3;2*(H,5,6,7) |
| InChIKey | TWXSTGRACJPPJM-UHFFFAOYSA-N |
| XLogP | 9.34 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.97 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|