C12H27NO3S — CID 175583831
1-butyl-3-propylpyrrolidine;methanesulfonic acid (PubChem CID 175583831) has the molecular formula C12H27NO3S and a molecular weight of 265.42 g/mol. Its IUPAC name is 1-butyl-3-propylpyrrolidine;methanesulfonic acid.
| Compound Name | 1-butyl-3-propylpyrrolidine;methanesulfonic acid |
|---|---|
| PubChem CID | 175583831 |
| Molecular Formula | C12H27NO3S |
| Molecular Weight | 265.42 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 1-butyl-3-propylpyrrolidine;methanesulfonic acid |
| SMILES | CCCCN1CCC(CCC)C1.CS(=O)(=O)O |
| InChI | InChI=1S/C11H23N.CH4O3S/c1-3-5-8-12-9-7-11(10-12)6-4-2;1-5(2,3)4/h11H,3-10H2,1-2H3;1H3,(H,2,3,4) |
| InChIKey | YCAZMJGIRYVTMX-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.42 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|