C19H41NO6S2 — CID 175584072
heptane-1,2-disulfonic acid;1-pentyl-3-propylpyrrolidine (PubChem CID 175584072) has the molecular formula C19H41NO6S2 and a molecular weight of 443.67 g/mol. Its IUPAC name is heptane-1,2-disulfonic acid;1-pentyl-3-propylpyrrolidine.
| Compound Name | heptane-1,2-disulfonic acid;1-pentyl-3-propylpyrrolidine |
|---|---|
| PubChem CID | 175584072 |
| Molecular Formula | C19H41NO6S2 |
| Molecular Weight | 443.67 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | heptane-1,2-disulfonic acid;1-pentyl-3-propylpyrrolidine |
| SMILES | CCCCCC(CS(=O)(=O)O)S(=O)(=O)O.CCCCCN1CCC(CCC)C1 |
| InChI | InChI=1S/C12H25N.C7H16O6S2/c1-3-5-6-9-13-10-8-12(11-13)7-4-2;1-2-3-4-5-7(15(11,12)13)6-14(8,9)10/h12H,3-11H2,1-2H3;7H,2-6H2,1H3,(H,8,9,10)(H,11,12,13) |
| InChIKey | NBZMACALPKZDKZ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.67 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|