C13H16BrF5N4S — CID 175586922
N-amino-5-bromo-3-ethylsulfanyl-N'-methylpyridine-2-carboximidamide;1,1,2,3,4-pentafluorocyclobutane (PubChem CID 175586922) has the molecular formula C13H16BrF5N4S and a molecular weight of 435.26 g/mol. Its IUPAC name is N-amino-5-bromo-3-ethylsulfanyl-N'-methylpyridine-2-carboximidamide;1,1,2,3,4-pentafluorocyclobutane.
| Compound Name | N-amino-5-bromo-3-ethylsulfanyl-N'-methylpyridine-2-carboximidamide;1,1,2,3,4-pentafluorocyclobutane |
|---|---|
| PubChem CID | 175586922 |
| Molecular Formula | C13H16BrF5N4S |
| Molecular Weight | 435.26 g/mol |
| Exact Mass | 434.02 |
| IUPAC Name | N-amino-5-bromo-3-ethylsulfanyl-N'-methylpyridine-2-carboximidamide;1,1,2,3,4-pentafluorocyclobutane |
| SMILES | CCSc1cc(Br)cnc1/C(=N/C)NN.FC1C(F)C(F)(F)C1F |
| InChI | InChI=1S/C9H13BrN4S.C4H3F5/c1-3-15-7-4-6(10)5-13-8(7)9(12-2)14-11;5-1-2(6)4(8,9)3(1)7/h4-5H,3,11H2,1-2H3,(H,12,14);1-3H |
| InChIKey | JBUNGKXFIFEQBP-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.26 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|