About [1-(5-bromo-3-ethylsulfanyl-2-pyridinyl)-1-oxopropan-2-yl] 3-oxopropanoate
[1-(5-bromo-3-ethylsulfanyl-2-pyridinyl)-1-oxopropan-2-yl] 3-oxopropanoate (PubChem CID 175586903) has the molecular formula C13H14BrNO4S
and a molecular weight of 360.23 g/mol. Its IUPAC name is [1-(5-bromo-3-ethylsulfanyl-2-pyridinyl)-1-oxopropan-2-yl] 3-oxopropanoate.
Molecular Properties
| Compound Name | [1-(5-bromo-3-ethylsulfanyl-2-pyridinyl)-1-oxopropan-2-yl] 3-oxopropanoate |
| PubChem CID | 175586903 |
| Molecular Formula | C13H14BrNO4S |
| Molecular Weight | 360.23 g/mol |
| Exact Mass | 358.98 |
| IUPAC Name | [1-(5-bromo-3-ethylsulfanyl-2-pyridinyl)-1-oxopropan-2-yl] 3-oxopropanoate |
| SMILES | CCSc1cc(Br)cnc1C(=O)C(C)OC(=O)CC=O |
| InChI | InChI=1S/C13H14BrNO4S/c1-3-20-10-6-9(14)7-15-12(10)13(18)8(2)19-11(17)4-5-16/h5-8H,3-4H2,1-2H3 |
| InChIKey | UHGLTXARNUUWFE-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.23 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze [1-(5-bromo-3-ethylsulfanyl-2-pyridinyl)-1-oxopropan-2-yl] 3-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(5-bromo-3-ethylsulfanyl-2-pyridinyl)-1-oxopropan-2-yl] 3-oxopropanoate?
The IUPAC name of [1-(5-bromo-3-ethylsulfanyl-2-pyridinyl)-1-oxopropan-2-yl] 3-oxopropanoate (CID 175586903) is [1-(5-bromo-3-ethylsulfanyl-2-pyridinyl)-1-oxopropan-2-yl] 3-oxopropanoate.
What is the SMILES notation for [1-(5-bromo-3-ethylsulfanyl-2-pyridinyl)-1-oxopropan-2-yl] 3-oxopropanoate?
The canonical SMILES for [1-(5-bromo-3-ethylsulfanyl-2-pyridinyl)-1-oxopropan-2-yl] 3-oxopropanoate is CCSc1cc(Br)cnc1C(=O)C(C)OC(=O)CC=O.
What is the InChIKey of [1-(5-bromo-3-ethylsulfanyl-2-pyridinyl)-1-oxopropan-2-yl] 3-oxopropanoate?
The InChIKey is UHGLTXARNUUWFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14BrNO4S/c1-3-20-10-6-9(14)7-15-12(10)13(18)8(2)19-11(17)4-5-16/h5-8H,3-4H2,1-2H3.
What are the key properties of [1-(5-bromo-3-ethylsulfanyl-2-pyridinyl)-1-oxopropan-2-yl] 3-oxopropanoate?
[1-(5-bromo-3-ethylsulfanyl-2-pyridinyl)-1-oxopropan-2-yl] 3-oxopropanoate has a molecular weight of 360.23 g/mol, XLogP of 2.66, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(5-bromo-3-ethylsulfanyl-2-pyridinyl)-1-oxopropan-2-yl] 3-oxopropanoate is sourced from PubChem (CID 175586903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).