C16H21NO6 — CID 175588100
3-(4-hydroxyphenyl)-2-(oxiran-2-ylmethylamino)propanoic acid;2-methylprop-2-enoic acid (PubChem CID 175588100) has the molecular formula C16H21NO6 and a molecular weight of 323.35 g/mol. Its IUPAC name is 3-(4-hydroxyphenyl)-2-(oxiran-2-ylmethylamino)propanoic acid;2-methylprop-2-enoic acid.
| Compound Name | 3-(4-hydroxyphenyl)-2-(oxiran-2-ylmethylamino)propanoic acid;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 175588100 |
| Molecular Formula | C16H21NO6 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 3-(4-hydroxyphenyl)-2-(oxiran-2-ylmethylamino)propanoic acid;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.O=C(O)C(Cc1ccc(O)cc1)NCC1CO1 |
| InChI | InChI=1S/C12H15NO4.C4H6O2/c14-9-3-1-8(2-4-9)5-11(12(15)16)13-6-10-7-17-10;1-3(2)4(5)6/h1-4,10-11,13-14H,5-7H2,(H,15,16);1H2,2H3,(H,5,6) |
| InChIKey | ZZISYURJUDZEFS-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|