C22H22F3N3O2S — CID 175591871
1-[4-(1H-pyrrol-2-yl)phenyl]sulfonyl-N-[4-(trifluoromethyl)phenyl]piperidin-4-amine (PubChem CID 175591871) has the molecular formula C22H22F3N3O2S and a molecular weight of 449.50 g/mol. Its IUPAC name is 1-[4-(1H-pyrrol-2-yl)phenyl]sulfonyl-N-[4-(trifluoromethyl)phenyl]piperidin-4-amine.
| Compound Name | 1-[4-(1H-pyrrol-2-yl)phenyl]sulfonyl-N-[4-(trifluoromethyl)phenyl]piperidin-4-amine |
|---|---|
| PubChem CID | 175591871 |
| Molecular Formula | C22H22F3N3O2S |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | 1-[4-(1H-pyrrol-2-yl)phenyl]sulfonyl-N-[4-(trifluoromethyl)phenyl]piperidin-4-amine |
| SMILES | O=S(=O)(c1ccc(-c2ccc[nH]2)cc1)N1CCC(Nc2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C22H22F3N3O2S/c23-22(24,25)17-5-7-18(8-6-17)27-19-11-14-28(15-12-19)31(29,30)20-9-3-16(4-10-20)21-2-1-13-26-21/h1-10,13,19,26-27H,11-12,14-15H2 |
| InChIKey | JDXAXLKPXPIYQX-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |