C24H50N2O7 — CID 175594555
2-[bis(2-hydroxyethyl)amino]ethanol;3-dodecyliminopropanoic acid;propanoic acid (PubChem CID 175594555) has the molecular formula C24H50N2O7 and a molecular weight of 478.67 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethyl)amino]ethanol;3-dodecyliminopropanoic acid;propanoic acid.
| Compound Name | 2-[bis(2-hydroxyethyl)amino]ethanol;3-dodecyliminopropanoic acid;propanoic acid |
|---|---|
| PubChem CID | 175594555 |
| Molecular Formula | C24H50N2O7 |
| Molecular Weight | 478.67 g/mol |
| Exact Mass | 478.36 |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]ethanol;3-dodecyliminopropanoic acid;propanoic acid |
| SMILES | CCC(=O)O.CCCCCCCCCCCC/N=C/CC(=O)O.OCCN(CCO)CCO |
| InChI | InChI=1S/C15H29NO2.C6H15NO3.C3H6O2/c1-2-3-4-5-6-7-8-9-10-11-13-16-14-12-15(17)18;8-4-1-7(2-5-9)3-6-10;1-2-3(4)5/h14H,2-13H2,1H3,(H,17,18);8-10H,1-6H2;2H2,1H3,(H,4,5)/b16-14+;; |
| InChIKey | NGCPFTLXWRZAJB-UPONXUSQSA-N |
| XLogP | 3.20 |
| TPSA | 150.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.67 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|