C27H40N4O7 — CID 175596129
tert-butyl 2-[[(2S)-2-[[2-[6-(2,5-dihydroxy-2,5-dihydropyrrol-1-yl)hexanoylamino]acetyl]amino]-3-phenylpropanoyl]amino]acetate (PubChem CID 175596129) has the molecular formula C27H40N4O7 and a molecular weight of 532.64 g/mol. Its IUPAC name is tert-butyl 2-[[(2S)-2-[[2-[6-(2,5-dihydroxy-2,5-dihydropyrrol-1-yl)hexanoylamino]acetyl]amino]-3-phenylpropanoyl]amino]acetate.
| Compound Name | tert-butyl 2-[[(2S)-2-[[2-[6-(2,5-dihydroxy-2,5-dihydropyrrol-1-yl)hexanoylamino]acetyl]amino]-3-phenylpropanoyl]amino]acetate |
|---|---|
| PubChem CID | 175596129 |
| Molecular Formula | C27H40N4O7 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.29 |
| IUPAC Name | tert-butyl 2-[[(2S)-2-[[2-[6-(2,5-dihydroxy-2,5-dihydropyrrol-1-yl)hexanoylamino]acetyl]amino]-3-phenylpropanoyl]amino]acetate |
| SMILES | CC(C)(C)OC(=O)CNC(=O)[C@H](Cc1ccccc1)NC(=O)CNC(=O)CCCCCN1C(O)C=CC1O |
| InChI | InChI=1S/C27H40N4O7/c1-27(2,3)38-25(36)18-29-26(37)20(16-19-10-6-4-7-11-19)30-22(33)17-28-21(32)12-8-5-9-15-31-23(34)13-14-24(31)35/h4,6-7,10-11,13-14,20,23-24,34-35H,5,8-9,12,15-18H2,1-3H3,(H,28,32)(H,29,37)(H,30,33)/t20-,23?,24?/m0/s1 |
| InChIKey | HXNOYYWYXGZLBJ-XOYNAWAESA-N |
| XLogP | 0.36 |
| TPSA | 157.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|