C22H29N3O5S — CID 175597168
[(2S)-3-methyl-1-(4-morpholin-4-ylanilino)-1-oxobutan-2-yl]-(4-methylphenyl)sulfamic acid (PubChem CID 175597168) has the molecular formula C22H29N3O5S and a molecular weight of 447.56 g/mol. Its IUPAC name is [(2S)-3-methyl-1-(4-morpholin-4-ylanilino)-1-oxobutan-2-yl]-(4-methylphenyl)sulfamic acid.
| Compound Name | [(2S)-3-methyl-1-(4-morpholin-4-ylanilino)-1-oxobutan-2-yl]-(4-methylphenyl)sulfamic acid |
|---|---|
| PubChem CID | 175597168 |
| Molecular Formula | C22H29N3O5S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | [(2S)-3-methyl-1-(4-morpholin-4-ylanilino)-1-oxobutan-2-yl]-(4-methylphenyl)sulfamic acid |
| SMILES | Cc1ccc(N([C@H](C(=O)Nc2ccc(N3CCOCC3)cc2)C(C)C)S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C22H29N3O5S/c1-16(2)21(25(31(27,28)29)20-8-4-17(3)5-9-20)22(26)23-18-6-10-19(11-7-18)24-12-14-30-15-13-24/h4-11,16,21H,12-15H2,1-3H3,(H,23,26)(H,27,28,29)/t21-/m0/s1 |
| InChIKey | KFIUYAVVOVDNKG-NRFANRHFSA-N |
| XLogP | 3.10 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|