About butan-1-amine;2-methylpropoxymethanedithioic acid
butan-1-amine;2-methylpropoxymethanedithioic acid (PubChem CID 175597383) has the molecular formula C9H21NOS2
and a molecular weight of 223.41 g/mol. Its IUPAC name is butan-1-amine;2-methylpropoxymethanedithioic acid.
Molecular Properties
| Compound Name | butan-1-amine;2-methylpropoxymethanedithioic acid |
| PubChem CID | 175597383 |
| Molecular Formula | C9H21NOS2 |
| Molecular Weight | 223.41 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | butan-1-amine;2-methylpropoxymethanedithioic acid |
| SMILES | CC(C)COC(=S)S.CCCCN |
| InChI | InChI=1S/C5H10OS2.C4H11N/c1-4(2)3-6-5(7)8;1-2-3-4-5/h4H,3H2,1-2H3,(H,7,8);2-5H2,1H3 |
| InChIKey | VEFQKDORRGAYML-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze butan-1-amine;2-methylpropoxymethanedithioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-1-amine;2-methylpropoxymethanedithioic acid?
The IUPAC name of butan-1-amine;2-methylpropoxymethanedithioic acid (CID 175597383) is butan-1-amine;2-methylpropoxymethanedithioic acid.
What is the SMILES notation for butan-1-amine;2-methylpropoxymethanedithioic acid?
The canonical SMILES for butan-1-amine;2-methylpropoxymethanedithioic acid is CC(C)COC(=S)S.CCCCN.
What is the InChIKey of butan-1-amine;2-methylpropoxymethanedithioic acid?
The InChIKey is VEFQKDORRGAYML-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10OS2.C4H11N/c1-4(2)3-6-5(7)8;1-2-3-4-5/h4H,3H2,1-2H3,(H,7,8);2-5H2,1H3.
What are the key properties of butan-1-amine;2-methylpropoxymethanedithioic acid?
butan-1-amine;2-methylpropoxymethanedithioic acid has a molecular weight of 223.41 g/mol, XLogP of 2.62, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butan-1-amine;2-methylpropoxymethanedithioic acid is sourced from PubChem (CID 175597383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).