C21H41N2O6P — CID 175597588
4,5-dihydro-1H-imidazole;(9Z,12Z)-octadeca-9,12-dienoic acid;phosphoric acid (PubChem CID 175597588) has the molecular formula C21H41N2O6P and a molecular weight of 448.54 g/mol. Its IUPAC name is 4,5-dihydro-1H-imidazole;(9Z,12Z)-octadeca-9,12-dienoic acid;phosphoric acid.
| Compound Name | 4,5-dihydro-1H-imidazole;(9Z,12Z)-octadeca-9,12-dienoic acid;phosphoric acid |
|---|---|
| PubChem CID | 175597588 |
| Molecular Formula | C21H41N2O6P |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.27 |
| IUPAC Name | 4,5-dihydro-1H-imidazole;(9Z,12Z)-octadeca-9,12-dienoic acid;phosphoric acid |
| SMILES | C1=NCCN1.CCCCC/C=C\C/C=C\CCCCCCCC(=O)O.O=P(O)(O)O |
| InChI | InChI=1S/C18H32O2.C3H6N2.H3O4P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-2-5-3-4-1;1-5(2,3)4/h6-7,9-10H,2-5,8,11-17H2,1H3,(H,19,20);3H,1-2H2,(H,4,5);(H3,1,2,3,4)/b7-6-,10-9-;; |
| InChIKey | VGQJDLUWAWPVNK-JFHYDWJLSA-N |
| XLogP | 4.57 |
| TPSA | 139.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|