C21H41N3O — CID 174834735
4,5-dihydro-1H-imidazole;(Z)-octadec-9-enamide (PubChem CID 174834735) has the molecular formula C21H41N3O and a molecular weight of 351.58 g/mol. Its IUPAC name is 4,5-dihydro-1H-imidazole;(Z)-octadec-9-enamide.
| Compound Name | 4,5-dihydro-1H-imidazole;(Z)-octadec-9-enamide |
|---|---|
| PubChem CID | 174834735 |
| Molecular Formula | C21H41N3O |
| Molecular Weight | 351.58 g/mol |
| Exact Mass | 351.32 |
| IUPAC Name | 4,5-dihydro-1H-imidazole;(Z)-octadec-9-enamide |
| SMILES | C1=NCCN1.CCCCCCCC/C=C\CCCCCCCC(N)=O |
| InChI | InChI=1S/C18H35NO.C3H6N2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-2-5-3-4-1/h9-10H,2-8,11-17H2,1H3,(H2,19,20);3H,1-2H2,(H,4,5)/b10-9-; |
| InChIKey | DLYIADMTZNYBSL-KVVVOXFISA-N |
| XLogP | 5.13 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.58 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|