C7H10Cl2O3 — CID 175601399
cis-(1R,5S)-2,3-dichloro-4,5-dihydroxycyclohexane-1-carbaldehyde (PubChem CID 175601399) has the molecular formula C7H10Cl2O3 and a molecular weight of 213.06 g/mol. Its IUPAC name is cis-(1R,5S)-2,3-dichloro-4,5-dihydroxycyclohexane-1-carbaldehyde.
| Compound Name | cis-(1R,5S)-2,3-dichloro-4,5-dihydroxycyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 175601399 |
| Molecular Formula | C7H10Cl2O3 |
| Molecular Weight | 213.06 g/mol |
| Exact Mass | 212.00 |
| IUPAC Name | cis-(1R,5S)-2,3-dichloro-4,5-dihydroxycyclohexane-1-carbaldehyde |
| SMILES | O=C[C@H]1C[C@H](O)C(O)C(Cl)C1Cl |
| InChI | InChI=1S/C7H10Cl2O3/c8-5-3(2-10)1-4(11)7(12)6(5)9/h2-7,11-12H,1H2/t3-,4+,5?,6?,7?/m1/s1 |
| InChIKey | OWOOMQCEWPUNMV-AEYVIUQBSA-N |
| XLogP | 0.14 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.06 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|