About methylamino cyclobutanecarboxylate;hydrochloride
methylamino cyclobutanecarboxylate;hydrochloride (PubChem CID 175601704) has the molecular formula C6H12ClNO2
and a molecular weight of 165.62 g/mol. Its IUPAC name is methylamino cyclobutanecarboxylate;hydrochloride.
Molecular Properties
| Compound Name | methylamino cyclobutanecarboxylate;hydrochloride |
| PubChem CID | 175601704 |
| Molecular Formula | C6H12ClNO2 |
| Molecular Weight | 165.62 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | methylamino cyclobutanecarboxylate;hydrochloride |
| SMILES | CNOC(=O)C1CCC1.Cl |
| InChI | InChI=1S/C6H11NO2.ClH/c1-7-9-6(8)5-3-2-4-5;/h5,7H,2-4H2,1H3;1H |
| InChIKey | LJFATWWBFORYQX-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.62 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methylamino cyclobutanecarboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylamino cyclobutanecarboxylate;hydrochloride?
The IUPAC name of methylamino cyclobutanecarboxylate;hydrochloride (CID 175601704) is methylamino cyclobutanecarboxylate;hydrochloride.
What is the SMILES notation for methylamino cyclobutanecarboxylate;hydrochloride?
The canonical SMILES for methylamino cyclobutanecarboxylate;hydrochloride is CNOC(=O)C1CCC1.Cl.
What is the InChIKey of methylamino cyclobutanecarboxylate;hydrochloride?
The InChIKey is LJFATWWBFORYQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO2.ClH/c1-7-9-6(8)5-3-2-4-5;/h5,7H,2-4H2,1H3;1H.
What are the key properties of methylamino cyclobutanecarboxylate;hydrochloride?
methylamino cyclobutanecarboxylate;hydrochloride has a molecular weight of 165.62 g/mol, XLogP of 0.89, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methylamino cyclobutanecarboxylate;hydrochloride is sourced from PubChem (CID 175601704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).