About fluoro 3-oxo-2-phenylbutanoate
fluoro 3-oxo-2-phenylbutanoate (PubChem CID 175606788) has the molecular formula C10H9FO3
and a molecular weight of 196.18 g/mol. Its IUPAC name is fluoro 3-oxo-2-phenylbutanoate.
Molecular Properties
| Compound Name | fluoro 3-oxo-2-phenylbutanoate |
| PubChem CID | 175606788 |
| Molecular Formula | C10H9FO3 |
| Molecular Weight | 196.18 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | fluoro 3-oxo-2-phenylbutanoate |
| SMILES | CC(=O)C(C(=O)OF)c1ccccc1 |
| InChI | InChI=1S/C10H9FO3/c1-7(12)9(10(13)14-11)8-5-3-2-4-6-8/h2-6,9H,1H3 |
| InChIKey | GCTIUHLDOJEDKQ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.18 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze fluoro 3-oxo-2-phenylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoro 3-oxo-2-phenylbutanoate?
The IUPAC name of fluoro 3-oxo-2-phenylbutanoate (CID 175606788) is fluoro 3-oxo-2-phenylbutanoate.
What is the SMILES notation for fluoro 3-oxo-2-phenylbutanoate?
The canonical SMILES for fluoro 3-oxo-2-phenylbutanoate is CC(=O)C(C(=O)OF)c1ccccc1.
What is the InChIKey of fluoro 3-oxo-2-phenylbutanoate?
The InChIKey is GCTIUHLDOJEDKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9FO3/c1-7(12)9(10(13)14-11)8-5-3-2-4-6-8/h2-6,9H,1H3.
What are the key properties of fluoro 3-oxo-2-phenylbutanoate?
fluoro 3-oxo-2-phenylbutanoate has a molecular weight of 196.18 g/mol, XLogP of 1.79, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for fluoro 3-oxo-2-phenylbutanoate is sourced from PubChem (CID 175606788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).