About phenyl 3-oxo-2-phenylbutanoate
phenyl 3-oxo-2-phenylbutanoate (PubChem CID 22555082) has the molecular formula C16H14O3
and a molecular weight of 254.29 g/mol. Its IUPAC name is phenyl 3-oxo-2-phenylbutanoate.
Molecular Properties
| Compound Name | phenyl 3-oxo-2-phenylbutanoate |
| PubChem CID | 22555082 |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | phenyl 3-oxo-2-phenylbutanoate |
| SMILES | CC(=O)C(C(=O)Oc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H14O3/c1-12(17)15(13-8-4-2-5-9-13)16(18)19-14-10-6-3-7-11-14/h2-11,15H,1H3 |
| InChIKey | ATXDREFPWABNMU-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze phenyl 3-oxo-2-phenylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl 3-oxo-2-phenylbutanoate?
The IUPAC name of phenyl 3-oxo-2-phenylbutanoate (CID 22555082) is phenyl 3-oxo-2-phenylbutanoate.
What is the SMILES notation for phenyl 3-oxo-2-phenylbutanoate?
The canonical SMILES for phenyl 3-oxo-2-phenylbutanoate is CC(=O)C(C(=O)Oc1ccccc1)c1ccccc1.
What is the InChIKey of phenyl 3-oxo-2-phenylbutanoate?
The InChIKey is ATXDREFPWABNMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O3/c1-12(17)15(13-8-4-2-5-9-13)16(18)19-14-10-6-3-7-11-14/h2-11,15H,1H3.
What are the key properties of phenyl 3-oxo-2-phenylbutanoate?
phenyl 3-oxo-2-phenylbutanoate has a molecular weight of 254.29 g/mol, XLogP of 2.96, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl 3-oxo-2-phenylbutanoate is sourced from PubChem (CID 22555082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).