C10H10O6S — CID 57249591
1,3-dioxo-1-phenoxybutane-2-sulfonic acid (PubChem CID 57249591) has the molecular formula C10H10O6S and a molecular weight of 258.25 g/mol. Its IUPAC name is 1,3-dioxo-1-phenoxybutane-2-sulfonic acid.
| Compound Name | 1,3-dioxo-1-phenoxybutane-2-sulfonic acid |
|---|---|
| PubChem CID | 57249591 |
| Molecular Formula | C10H10O6S |
| Molecular Weight | 258.25 g/mol |
| Exact Mass | 258.02 |
| IUPAC Name | 1,3-dioxo-1-phenoxybutane-2-sulfonic acid |
| SMILES | CC(=O)C(C(=O)Oc1ccccc1)S(=O)(=O)O |
| InChI | InChI=1S/C10H10O6S/c1-7(11)9(17(13,14)15)10(12)16-8-5-3-2-4-6-8/h2-6,9H,1H3,(H,13,14,15) |
| InChIKey | WNKJIHBLLGFEOX-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.25 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|