C12H22O2 — CID 175611418
3-methoxy-6,10-dimethyl-3,4,5,6,7,10-hexahydro-2H-oxecine (PubChem CID 175611418) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is 3-methoxy-6,10-dimethyl-3,4,5,6,7,10-hexahydro-2H-oxecine.
| Compound Name | 3-methoxy-6,10-dimethyl-3,4,5,6,7,10-hexahydro-2H-oxecine |
|---|---|
| PubChem CID | 175611418 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | 3-methoxy-6,10-dimethyl-3,4,5,6,7,10-hexahydro-2H-oxecine |
| SMILES | COC1CCC(C)CC=CC(C)OC1 |
| InChI | InChI=1S/C12H22O2/c1-10-5-4-6-11(2)14-9-12(13-3)8-7-10/h4,6,10-12H,5,7-9H2,1-3H3 |
| InChIKey | YJFMUSLUIRMPNE-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|