C15H28O — CID 21450091
2-heptyl-5-(2-methylpropyl)-2,5-dihydrofuran (PubChem CID 21450091) has the molecular formula C15H28O and a molecular weight of 224.39 g/mol. Its IUPAC name is 2-heptyl-5-(2-methylpropyl)-2,5-dihydrofuran.
| Compound Name | 2-heptyl-5-(2-methylpropyl)-2,5-dihydrofuran |
|---|---|
| PubChem CID | 21450091 |
| Molecular Formula | C15H28O |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.21 |
| IUPAC Name | 2-heptyl-5-(2-methylpropyl)-2,5-dihydrofuran |
| SMILES | CCCCCCCC1C=CC(CC(C)C)O1 |
| InChI | InChI=1S/C15H28O/c1-4-5-6-7-8-9-14-10-11-15(16-14)12-13(2)3/h10-11,13-15H,4-9,12H2,1-3H3 |
| InChIKey | HPBLPIIYKQYPBK-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|