C16H28O3 — CID 102298609
[(2R,3S,6R)-3-methyl-6-pentyl-3,6-dihydro-2H-pyran-2-yl] 2,2-dimethylpropanoate (PubChem CID 102298609) has the molecular formula C16H28O3 and a molecular weight of 268.40 g/mol. Its IUPAC name is [(2R,3S,6R)-3-methyl-6-pentyl-3,6-dihydro-2H-pyran-2-yl] 2,2-dimethylpropanoate.
| Compound Name | [(2R,3S,6R)-3-methyl-6-pentyl-3,6-dihydro-2H-pyran-2-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 102298609 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | [(2R,3S,6R)-3-methyl-6-pentyl-3,6-dihydro-2H-pyran-2-yl] 2,2-dimethylpropanoate |
| SMILES | CCCCC[C@@H]1C=C[C@H](C)[C@@H](OC(=O)C(C)(C)C)O1 |
| InChI | InChI=1S/C16H28O3/c1-6-7-8-9-13-11-10-12(2)14(18-13)19-15(17)16(3,4)5/h10-14H,6-9H2,1-5H3/t12-,13+,14+/m0/s1 |
| InChIKey | GFSQVZLDZOWDBK-BFHYXJOUSA-N |
| XLogP | 4.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|