C22H32O4 — CID 102298614
[(2R,3R,6R)-3-(2-methoxyphenyl)-6-pentyl-3,6-dihydro-2H-pyran-2-yl] 2,2-dimethylpropanoate (PubChem CID 102298614) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is [(2R,3R,6R)-3-(2-methoxyphenyl)-6-pentyl-3,6-dihydro-2H-pyran-2-yl] 2,2-dimethylpropanoate.
| Compound Name | [(2R,3R,6R)-3-(2-methoxyphenyl)-6-pentyl-3,6-dihydro-2H-pyran-2-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 102298614 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | [(2R,3R,6R)-3-(2-methoxyphenyl)-6-pentyl-3,6-dihydro-2H-pyran-2-yl] 2,2-dimethylpropanoate |
| SMILES | CCCCC[C@@H]1C=C[C@H](c2ccccc2OC)[C@@H](OC(=O)C(C)(C)C)O1 |
| InChI | InChI=1S/C22H32O4/c1-6-7-8-11-16-14-15-18(17-12-9-10-13-19(17)24-5)20(25-16)26-21(23)22(2,3)4/h9-10,12-16,18,20H,6-8,11H2,1-5H3/t16-,18-,20-/m1/s1 |
| InChIKey | BDRBTHJBTGMTJJ-YVWKXTFCSA-N |
| XLogP | 5.23 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|