C15H17Cl2N — CID 175611502
N-[1-(2-bicyclo[2.2.1]heptanyl)ethenyl]-3,4-dichloroaniline (PubChem CID 175611502) has the molecular formula C15H17Cl2N and a molecular weight of 282.21 g/mol. Its IUPAC name is N-[1-(2-bicyclo[2.2.1]heptanyl)ethenyl]-3,4-dichloroaniline.
| Compound Name | N-[1-(2-bicyclo[2.2.1]heptanyl)ethenyl]-3,4-dichloroaniline |
|---|---|
| PubChem CID | 175611502 |
| Molecular Formula | C15H17Cl2N |
| Molecular Weight | 282.21 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | N-[1-(2-bicyclo[2.2.1]heptanyl)ethenyl]-3,4-dichloroaniline |
| SMILES | C=C(Nc1ccc(Cl)c(Cl)c1)C1CC2CCC1C2 |
| InChI | InChI=1S/C15H17Cl2N/c1-9(13-7-10-2-3-11(13)6-10)18-12-4-5-14(16)15(17)8-12/h4-5,8,10-11,13,18H,1-3,6-7H2 |
| InChIKey | KFPCUPZBPMCJQA-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.21 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |