C15H29N — CID 175612290
2-ethyl-5,6-di(propan-2-yl)-5-azaspiro[2.5]octane (PubChem CID 175612290) has the molecular formula C15H29N and a molecular weight of 223.40 g/mol. Its IUPAC name is 2-ethyl-5,6-di(propan-2-yl)-5-azaspiro[2.5]octane.
| Compound Name | 2-ethyl-5,6-di(propan-2-yl)-5-azaspiro[2.5]octane |
|---|---|
| PubChem CID | 175612290 |
| Molecular Formula | C15H29N |
| Molecular Weight | 223.40 g/mol |
| Exact Mass | 223.23 |
| IUPAC Name | 2-ethyl-5,6-di(propan-2-yl)-5-azaspiro[2.5]octane |
| SMILES | CCC1CC12CCC(C(C)C)N(C(C)C)C2 |
| InChI | InChI=1S/C15H29N/c1-6-13-9-15(13)8-7-14(11(2)3)16(10-15)12(4)5/h11-14H,6-10H2,1-5H3 |
| InChIKey | JCBAFQONLNQDKC-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.40 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |