C24H20N2O6 — CID 175617361
1-[4-[[4-(2,5-dioxopyrrol-1-yl)-3-ethyl-5-hydroxyphenyl]methyl]-2-hydroxy-6-methylphenyl]pyrrole-2,5-dione (PubChem CID 175617361) has the molecular formula C24H20N2O6 and a molecular weight of 432.43 g/mol. Its IUPAC name is 1-[4-[[4-(2,5-dioxopyrrol-1-yl)-3-ethyl-5-hydroxyphenyl]methyl]-2-hydroxy-6-methylphenyl]pyrrole-2,5-dione.
| Compound Name | 1-[4-[[4-(2,5-dioxopyrrol-1-yl)-3-ethyl-5-hydroxyphenyl]methyl]-2-hydroxy-6-methylphenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 175617361 |
| Molecular Formula | C24H20N2O6 |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | 1-[4-[[4-(2,5-dioxopyrrol-1-yl)-3-ethyl-5-hydroxyphenyl]methyl]-2-hydroxy-6-methylphenyl]pyrrole-2,5-dione |
| SMILES | CCc1cc(Cc2cc(C)c(N3C(=O)C=CC3=O)c(O)c2)cc(O)c1N1C(=O)C=CC1=O |
| InChI | InChI=1S/C24H20N2O6/c1-3-16-10-15(12-18(28)24(16)26-21(31)6-7-22(26)32)9-14-8-13(2)23(17(27)11-14)25-19(29)4-5-20(25)30/h4-8,10-12,27-28H,3,9H2,1-2H3 |
| InChIKey | XNJSTRICIHKGQE-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|