C16H16N2O3 — CID 69004958
10-hydroxy-1,4,6,9-tetramethylpyrido[3,2-g]quinoline-2,8-dione (PubChem CID 69004958) has the molecular formula C16H16N2O3 and a molecular weight of 284.31 g/mol. Its IUPAC name is 10-hydroxy-1,4,6,9-tetramethylpyrido[3,2-g]quinoline-2,8-dione.
| Compound Name | 10-hydroxy-1,4,6,9-tetramethylpyrido[3,2-g]quinoline-2,8-dione |
|---|---|
| PubChem CID | 69004958 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 10-hydroxy-1,4,6,9-tetramethylpyrido[3,2-g]quinoline-2,8-dione |
| SMILES | Cc1cc(=O)n(C)c2c(O)c3c(cc12)c(C)cc(=O)n3C |
| InChI | InChI=1S/C16H16N2O3/c1-8-5-12(19)17(3)14-10(8)7-11-9(2)6-13(20)18(4)15(11)16(14)21/h5-7,21H,1-4H3 |
| InChIKey | CKHJQWGAUDMNBP-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 64.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|