C7H12N2O2S2 — CID 175619867
3-[1-(disulfanyl)propyl]-1-methylimidazolidine-2,4-dione (PubChem CID 175619867) has the molecular formula C7H12N2O2S2 and a molecular weight of 220.32 g/mol. Its IUPAC name is 3-[1-(disulfanyl)propyl]-1-methylimidazolidine-2,4-dione.
| Compound Name | 3-[1-(disulfanyl)propyl]-1-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 175619867 |
| Molecular Formula | C7H12N2O2S2 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | 3-[1-(disulfanyl)propyl]-1-methylimidazolidine-2,4-dione |
| SMILES | CCC(SS)N1C(=O)CN(C)C1=O |
| InChI | InChI=1S/C7H12N2O2S2/c1-3-6(13-12)9-5(10)4-8(2)7(9)11/h6,12H,3-4H2,1-2H3 |
| InChIKey | ZUAKIFPUBXWBBR-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 40.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|