About N-[(4S)-3,3-difluoro-1-(2-methoxyethyl)piperidin-4-yl]-2,2-dimethylpropanamide
N-[(4S)-3,3-difluoro-1-(2-methoxyethyl)piperidin-4-yl]-2,2-dimethylpropanamide (PubChem CID 175623541) has the molecular formula C13H24F2N2O2
and a molecular weight of 278.34 g/mol. Its IUPAC name is N-[(4S)-3,3-difluoro-1-(2-methoxyethyl)piperidin-4-yl]-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-[(4S)-3,3-difluoro-1-(2-methoxyethyl)piperidin-4-yl]-2,2-dimethylpropanamide |
| PubChem CID | 175623541 |
| Molecular Formula | C13H24F2N2O2 |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | N-[(4S)-3,3-difluoro-1-(2-methoxyethyl)piperidin-4-yl]-2,2-dimethylpropanamide |
| SMILES | COCCN1CC[C@H](NC(=O)C(C)(C)C)C(F)(F)C1 |
| InChI | InChI=1S/C13H24F2N2O2/c1-12(2,3)11(18)16-10-5-6-17(7-8-19-4)9-13(10,14)15/h10H,5-9H2,1-4H3,(H,16,18)/t10-/m0/s1 |
| InChIKey | HLQHONGAYGKHCL-JTQLQIEISA-N |
| XLogP | 1.50 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(4S)-3,3-difluoro-1-(2-methoxyethyl)piperidin-4-yl]-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4S)-3,3-difluoro-1-(2-methoxyethyl)piperidin-4-yl]-2,2-dimethylpropanamide?
The IUPAC name of N-[(4S)-3,3-difluoro-1-(2-methoxyethyl)piperidin-4-yl]-2,2-dimethylpropanamide (CID 175623541) is N-[(4S)-3,3-difluoro-1-(2-methoxyethyl)piperidin-4-yl]-2,2-dimethylpropanamide.
What is the SMILES notation for N-[(4S)-3,3-difluoro-1-(2-methoxyethyl)piperidin-4-yl]-2,2-dimethylpropanamide?
The canonical SMILES for N-[(4S)-3,3-difluoro-1-(2-methoxyethyl)piperidin-4-yl]-2,2-dimethylpropanamide is COCCN1CC[C@H](NC(=O)C(C)(C)C)C(F)(F)C1.
What is the InChIKey of N-[(4S)-3,3-difluoro-1-(2-methoxyethyl)piperidin-4-yl]-2,2-dimethylpropanamide?
The InChIKey is HLQHONGAYGKHCL-JTQLQIEISA-N. The full InChI is InChI=1S/C13H24F2N2O2/c1-12(2,3)11(18)16-10-5-6-17(7-8-19-4)9-13(10,14)15/h10H,5-9H2,1-4H3,(H,16,18)/t10-/m0/s1.
What are the key properties of N-[(4S)-3,3-difluoro-1-(2-methoxyethyl)piperidin-4-yl]-2,2-dimethylpropanamide?
N-[(4S)-3,3-difluoro-1-(2-methoxyethyl)piperidin-4-yl]-2,2-dimethylpropanamide has a molecular weight of 278.34 g/mol, XLogP of 1.50, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4S)-3,3-difluoro-1-(2-methoxyethyl)piperidin-4-yl]-2,2-dimethylpropanamide is sourced from PubChem (CID 175623541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).