C9H16ClN — CID 175624735
(1E)-2-chloro-4-methyl-N-propan-2-ylpenta-1,4-dien-1-amine (PubChem CID 175624735) has the molecular formula C9H16ClN and a molecular weight of 173.69 g/mol. Its IUPAC name is (1E)-2-chloro-4-methyl-N-propan-2-ylpenta-1,4-dien-1-amine.
| Compound Name | (1E)-2-chloro-4-methyl-N-propan-2-ylpenta-1,4-dien-1-amine |
|---|---|
| PubChem CID | 175624735 |
| Molecular Formula | C9H16ClN |
| Molecular Weight | 173.69 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | (1E)-2-chloro-4-methyl-N-propan-2-ylpenta-1,4-dien-1-amine |
| SMILES | C=C(C)C/C(Cl)=C\NC(C)C |
| InChI | InChI=1S/C9H16ClN/c1-7(2)5-9(10)6-11-8(3)4/h6,8,11H,1,5H2,2-4H3/b9-6+ |
| InChIKey | DBBQOCIIQRGMBH-RMKNXTFCSA-N |
| XLogP | 3.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.69 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|