C31H17F6N5O2 — CID 175626070
2,6-bis[4-cyano-3-(trifluoromethyl)phenyl]-3,5-dioxo-1,2,3a,4,4a,6,7,7a,8,8a-decahydro-s-indacene-1,7,8-tricarbonitrile (PubChem CID 175626070) has the molecular formula C31H17F6N5O2 and a molecular weight of 605.50 g/mol. Its IUPAC name is 2,6-bis[4-cyano-3-(trifluoromethyl)phenyl]-3,5-dioxo-1,2,3a,4,4a,6,7,7a,8,8a-decahydro-s-indacene-1,7,8-tricarbonitrile.
| Compound Name | 2,6-bis[4-cyano-3-(trifluoromethyl)phenyl]-3,5-dioxo-1,2,3a,4,4a,6,7,7a,8,8a-decahydro-s-indacene-1,7,8-tricarbonitrile |
|---|---|
| PubChem CID | 175626070 |
| Molecular Formula | C31H17F6N5O2 |
| Molecular Weight | 605.50 g/mol |
| Exact Mass | 605.13 |
| IUPAC Name | 2,6-bis[4-cyano-3-(trifluoromethyl)phenyl]-3,5-dioxo-1,2,3a,4,4a,6,7,7a,8,8a-decahydro-s-indacene-1,7,8-tricarbonitrile |
| SMILES | N#Cc1ccc(C2C(=O)C3CC4C(=O)C(c5ccc(C#N)c(C(F)(F)F)c5)C(C#N)C4C(C#N)C3C2C#N)cc1C(F)(F)F |
| InChI | InChI=1S/C31H17F6N5O2/c32-30(33,34)22-5-13(1-3-15(22)8-38)24-19(10-40)26-17(28(24)43)7-18-27(21(26)12-42)20(11-41)25(29(18)44)14-2-4-16(9-39)23(6-14)31(35,36)37/h1-6,17-21,24-27H,7H2 |
| InChIKey | VDKOABOEJMRXCV-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 153.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.50 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |