C13H13NO — CID 175626409
1-(2,5-dimethylquinolin-6-yl)ethanone (PubChem CID 175626409) has the molecular formula C13H13NO and a molecular weight of 199.25 g/mol. Its IUPAC name is 1-(2,5-dimethylquinolin-6-yl)ethanone.
| Compound Name | 1-(2,5-dimethylquinolin-6-yl)ethanone |
|---|---|
| PubChem CID | 175626409 |
| Molecular Formula | C13H13NO |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 1-(2,5-dimethylquinolin-6-yl)ethanone |
| SMILES | CC(=O)c1ccc2nc(C)ccc2c1C |
| InChI | InChI=1S/C13H13NO/c1-8-4-5-12-9(2)11(10(3)15)6-7-13(12)14-8/h4-7H,1-3H3 |
| InChIKey | UQDNWZPGLVPMCM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |