C48H33BN4O5 — CID 175626912
CID 175626912 (PubChem CID 175626912) has the molecular formula C48H33BN4O5 and a molecular weight of 756.63 g/mol.
| Compound Name | CID 175626912 |
|---|---|
| PubChem CID | 175626912 |
| Molecular Formula | C48H33BN4O5 |
| Molecular Weight | 756.63 g/mol |
| Exact Mass | 756.25 |
| IUPAC Name | — |
| SMILES | [B]c1c(C)c(O)c(O)c2c1c1c(O)c(O)c(C)c(O)c1n2-c1ccc(-c2ccc3c(c2)-c2c(cccc2-c2nc(-c4ccccc4)nc(-c4ccccc4)n2)C3)cc1 |
| InChI | InChI=1S/C48H33BN4O5/c1-24-38(49)36-37-40(41(54)25(2)43(56)44(37)57)53(39(36)45(58)42(24)55)32-20-18-26(19-21-32)29-16-17-30-22-31-14-9-15-33(35(31)34(30)23-29)48-51-46(27-10-5-3-6-11-27)50-47(52-48)28-12-7-4-8-13-28/h3-21,23,54-58H,22H2,1-2H3 |
| InChIKey | PNHGJLNUUNTEHF-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 144.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.63 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|